C30H32FN4O6PS — CID 176807855
[2-[[(1R,3R,5S,7S,10S)-10-[3-(4-fluoro-3-pyridinyl)azetidine-1-carbonyl]-8-oxo-9-azatricyclo[7.3.0.03,5]dodecan-7-yl]carbamoyl]-1-benzothiophen-5-yl]methylphosphonic acid (PubChem CID 176807855) has the molecular formula C30H32FN4O6PS and a molecular weight of 626.65 g/mol. Its IUPAC name is [2-[[(1R,3R,5S,7S,10S)-10-[3-(4-fluoro-3-pyridinyl)azetidine-1-carbonyl]-8-oxo-9-azatricyclo[7.3.0.03,5]dodecan-7-yl]carbamoyl]-1-benzothiophen-5-yl]methylphosphonic acid.
| Compound Name | [2-[[(1R,3R,5S,7S,10S)-10-[3-(4-fluoro-3-pyridinyl)azetidine-1-carbonyl]-8-oxo-9-azatricyclo[7.3.0.03,5]dodecan-7-yl]carbamoyl]-1-benzothiophen-5-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 176807855 |
| Molecular Formula | C30H32FN4O6PS |
| Molecular Weight | 626.65 g/mol |
| Exact Mass | 626.18 |
| IUPAC Name | [2-[[(1R,3R,5S,7S,10S)-10-[3-(4-fluoro-3-pyridinyl)azetidine-1-carbonyl]-8-oxo-9-azatricyclo[7.3.0.03,5]dodecan-7-yl]carbamoyl]-1-benzothiophen-5-yl]methylphosphonic acid |
| SMILES | O=C(N[C@H]1C[C@@H]2C[C@@H]2C[C@H]2CC[C@@H](C(=O)N3CC(c4cnccc4F)C3)N2C1=O)c1cc2cc(CP(=O)(O)O)ccc2s1 |
| InChI | InChI=1S/C30H32FN4O6PS/c31-23-5-6-32-12-22(23)20-13-34(14-20)30(38)25-3-2-21-9-17-8-18(17)10-24(29(37)35(21)25)33-28(36)27-11-19-7-16(15-42(39,40)41)1-4-26(19)43-27/h1,4-7,11-12,17-18,20-21,24-25H,2-3,8-10,13-15H2,(H,33,36)(H2,39,40,41)/t17-,18+,21-,24+,25+/m1/s1 |
| InChIKey | ADXRWYMFOKNKDA-VNKYDURTSA-N |
| XLogP | 3.63 |
| TPSA | 140.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.65 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|