C11H12F3OS+ — CID 176808022
4-[2-(trifluoromethyl)phenyl]-1,4-oxathian-4-ium (PubChem CID 176808022) has the molecular formula C11H12F3OS+ and a molecular weight of 249.28 g/mol. Its IUPAC name is 4-[2-(trifluoromethyl)phenyl]-1,4-oxathian-4-ium.
| Compound Name | 4-[2-(trifluoromethyl)phenyl]-1,4-oxathian-4-ium |
|---|---|
| PubChem CID | 176808022 |
| Molecular Formula | C11H12F3OS+ |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 4-[2-(trifluoromethyl)phenyl]-1,4-oxathian-4-ium |
| SMILES | FC(F)(F)c1ccccc1[S+]1CCOCC1 |
| InChI | InChI=1S/C11H12F3OS/c12-11(13,14)9-3-1-2-4-10(9)16-7-5-15-6-8-16/h1-4H,5-8H2/q+1 |
| InChIKey | OASHFLBJSFRGET-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|