C19H21N9O2 — CID 176808058
(14R)-11,11-dideuterio-7,14-dimethyl-21-(methylamino)-12-oxa-2,5,6,7,15,19,23,24-octazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3,5,8,10(25),17,19,21-octaen-16-one (PubChem CID 176808058) has the molecular formula C19H21N9O2 and a molecular weight of 409.45 g/mol. Its IUPAC name is (14R)-11,11-dideuterio-7,14-dimethyl-21-(methylamino)-12-oxa-2,5,6,7,15,19,23,24-octazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3,5,8,10(25),17,19,21-octaen-16-one.
| Compound Name | (14R)-11,11-dideuterio-7,14-dimethyl-21-(methylamino)-12-oxa-2,5,6,7,15,19,23,24-octazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3,5,8,10(25),17,19,21-octaen-16-one |
|---|---|
| PubChem CID | 176808058 |
| Molecular Formula | C19H21N9O2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (14R)-11,11-dideuterio-7,14-dimethyl-21-(methylamino)-12-oxa-2,5,6,7,15,19,23,24-octazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3,5,8,10(25),17,19,21-octaen-16-one |
| SMILES | [2H]C1([2H])OC[C@@H](C)NC(=O)c2cnc3c(NC)cc(nn23)Nc2cc1cc1c2nnn1C |
| InChI | InChI=1S/C19H21N9O2/c1-10-8-30-9-11-4-12(17-14(5-11)27(3)26-24-17)23-16-6-13(20-2)18-21-7-15(19(29)22-10)28(18)25-16/h4-7,10,20H,8-9H2,1-3H3,(H,22,29)(H,23,25)/t10-/m1/s1/i9D2 |
| InChIKey | DIABQBQBKJCPFW-XQAYAABFSA-N |
| XLogP | 1.44 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|