About [3-(hydroxymethyl)-5-azabicyclo[2.1.0]penta-1(4),2-dien-2-yl]methanol
[3-(hydroxymethyl)-5-azabicyclo[2.1.0]penta-1(4),2-dien-2-yl]methanol (PubChem CID 176808727) has the molecular formula C6H7NO2
and a molecular weight of 125.13 g/mol. Its IUPAC name is [3-(hydroxymethyl)-5-azabicyclo[2.1.0]penta-1(4),2-dien-2-yl]methanol.
Molecular Properties
| Compound Name | [3-(hydroxymethyl)-5-azabicyclo[2.1.0]penta-1(4),2-dien-2-yl]methanol |
| PubChem CID | 176808727 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | [3-(hydroxymethyl)-5-azabicyclo[2.1.0]penta-1(4),2-dien-2-yl]methanol |
| SMILES | OCc1c(CO)c2[nH]c1=2 |
| InChI | InChI=1S/C6H7NO2/c8-1-3-4(2-9)6-5(3)7-6/h7-9H,1-2H2 |
| InChIKey | VMRJJOSUHZDQNU-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-(hydroxymethyl)-5-azabicyclo[2.1.0]penta-1(4),2-dien-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(hydroxymethyl)-5-azabicyclo[2.1.0]penta-1(4),2-dien-2-yl]methanol?
The IUPAC name of [3-(hydroxymethyl)-5-azabicyclo[2.1.0]penta-1(4),2-dien-2-yl]methanol (CID 176808727) is [3-(hydroxymethyl)-5-azabicyclo[2.1.0]penta-1(4),2-dien-2-yl]methanol.
What is the SMILES notation for [3-(hydroxymethyl)-5-azabicyclo[2.1.0]penta-1(4),2-dien-2-yl]methanol?
The canonical SMILES for [3-(hydroxymethyl)-5-azabicyclo[2.1.0]penta-1(4),2-dien-2-yl]methanol is OCc1c(CO)c2[nH]c1=2.
What is the InChIKey of [3-(hydroxymethyl)-5-azabicyclo[2.1.0]penta-1(4),2-dien-2-yl]methanol?
The InChIKey is VMRJJOSUHZDQNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2/c8-1-3-4(2-9)6-5(3)7-6/h7-9H,1-2H2.
What are the key properties of [3-(hydroxymethyl)-5-azabicyclo[2.1.0]penta-1(4),2-dien-2-yl]methanol?
[3-(hydroxymethyl)-5-azabicyclo[2.1.0]penta-1(4),2-dien-2-yl]methanol has a molecular weight of 125.13 g/mol, XLogP of -0.40, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(hydroxymethyl)-5-azabicyclo[2.1.0]penta-1(4),2-dien-2-yl]methanol is sourced from PubChem (CID 176808727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).