C18H20FN3O — CID 176809700
2-[3-(5-fluoropyrimidin-2-yl)phenyl]-1-[(2S)-2-methylpiperidin-1-yl]ethanone (PubChem CID 176809700) has the molecular formula C18H20FN3O and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-[3-(5-fluoropyrimidin-2-yl)phenyl]-1-[(2S)-2-methylpiperidin-1-yl]ethanone.
| Compound Name | 2-[3-(5-fluoropyrimidin-2-yl)phenyl]-1-[(2S)-2-methylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 176809700 |
| Molecular Formula | C18H20FN3O |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 2-[3-(5-fluoropyrimidin-2-yl)phenyl]-1-[(2S)-2-methylpiperidin-1-yl]ethanone |
| SMILES | C[C@H]1CCCCN1C(=O)Cc1cccc(-c2ncc(F)cn2)c1 |
| InChI | InChI=1S/C18H20FN3O/c1-13-5-2-3-8-22(13)17(23)10-14-6-4-7-15(9-14)18-20-11-16(19)12-21-18/h4,6-7,9,11-13H,2-3,5,8,10H2,1H3/t13-/m0/s1 |
| InChIKey | YRFIZQJRUGIBKD-ZDUSSCGKSA-N |
| XLogP | 3.23 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |