C14H16N2O2 — CID 176809773
[5-(2-methylpropyl)-1-phenylpyrazol-3-yl] formate (PubChem CID 176809773) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is [5-(2-methylpropyl)-1-phenylpyrazol-3-yl] formate.
| Compound Name | [5-(2-methylpropyl)-1-phenylpyrazol-3-yl] formate |
|---|---|
| PubChem CID | 176809773 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | [5-(2-methylpropyl)-1-phenylpyrazol-3-yl] formate |
| SMILES | CC(C)Cc1cc(OC=O)nn1-c1ccccc1 |
| InChI | InChI=1S/C14H16N2O2/c1-11(2)8-13-9-14(18-10-17)15-16(13)12-6-4-3-5-7-12/h3-7,9-11H,8H2,1-2H3 |
| InChIKey | WHUJQWZBGAWXRY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|