C26H27N2+ — CID 176809931
1-(6-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)-5-(1-phenylethyl)pyrrolo[3,2-c]pyridin-5-ium (PubChem CID 176809931) has the molecular formula C26H27N2+ and a molecular weight of 367.52 g/mol. Its IUPAC name is 1-(6-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)-5-(1-phenylethyl)pyrrolo[3,2-c]pyridin-5-ium.
| Compound Name | 1-(6-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)-5-(1-phenylethyl)pyrrolo[3,2-c]pyridin-5-ium |
|---|---|
| PubChem CID | 176809931 |
| Molecular Formula | C26H27N2+ |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | 1-(6-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)-5-(1-phenylethyl)pyrrolo[3,2-c]pyridin-5-ium |
| SMILES | Cc1ccc2c(c1)CCC(n1ccc3c[n+](C(C)c4ccccc4)ccc31)C2 |
| InChI | InChI=1S/C26H27N2/c1-19-8-9-23-17-25(11-10-22(23)16-19)28-15-12-24-18-27(14-13-26(24)28)20(2)21-6-4-3-5-7-21/h3-9,12-16,18,20,25H,10-11,17H2,1-2H3/q+1 |
| InChIKey | MTACFCQQCZZBNW-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|