C22H27N5O8S — CID 176810118
2-methoxyethyl (1S,2R,5R)-2-(hydroxycarbamoyl)-3-[[6-[(6-methyl-3-pyridinyl)oxy]-3-pyridinyl]sulfonyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 176810118) has the molecular formula C22H27N5O8S and a molecular weight of 521.55 g/mol. Its IUPAC name is 2-methoxyethyl (1S,2R,5R)-2-(hydroxycarbamoyl)-3-[[6-[(6-methyl-3-pyridinyl)oxy]-3-pyridinyl]sulfonyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | 2-methoxyethyl (1S,2R,5R)-2-(hydroxycarbamoyl)-3-[[6-[(6-methyl-3-pyridinyl)oxy]-3-pyridinyl]sulfonyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 176810118 |
| Molecular Formula | C22H27N5O8S |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | 2-methoxyethyl (1S,2R,5R)-2-(hydroxycarbamoyl)-3-[[6-[(6-methyl-3-pyridinyl)oxy]-3-pyridinyl]sulfonyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | COCCOC(=O)N1[C@@H]2CC[C@H]1[C@H](C(=O)NO)N(S(=O)(=O)c1ccc(Oc3ccc(C)nc3)nc1)C2 |
| InChI | InChI=1S/C22H27N5O8S/c1-14-3-5-16(11-23-14)35-19-8-6-17(12-24-19)36(31,32)26-13-15-4-7-18(20(26)21(28)25-30)27(15)22(29)34-10-9-33-2/h3,5-6,8,11-12,15,18,20,30H,4,7,9-10,13H2,1-2H3,(H,25,28)/t15-,18+,20-/m1/s1 |
| InChIKey | KNZVQKACQMXADD-MOXGXCLJSA-N |
| XLogP | 1.07 |
| TPSA | 160.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|