C60H39NO — CID 176810450
2,3,5,6-tetradeuterio-4-dibenzofuran-1-yl-N-(4-naphthalen-1-ylphenyl)-N-[4-(4-phenanthren-1-ylphenyl)phenyl]aniline (PubChem CID 176810450) has the molecular formula C60H39NO and a molecular weight of 794.00 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-4-dibenzofuran-1-yl-N-(4-naphthalen-1-ylphenyl)-N-[4-(4-phenanthren-1-ylphenyl)phenyl]aniline.
| Compound Name | 2,3,5,6-tetradeuterio-4-dibenzofuran-1-yl-N-(4-naphthalen-1-ylphenyl)-N-[4-(4-phenanthren-1-ylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 176810450 |
| Molecular Formula | C60H39NO |
| Molecular Weight | 794.00 g/mol |
| Exact Mass | 793.33 |
| IUPAC Name | 2,3,5,6-tetradeuterio-4-dibenzofuran-1-yl-N-(4-naphthalen-1-ylphenyl)-N-[4-(4-phenanthren-1-ylphenyl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3ccc(-c4cccc5c4ccc4ccccc45)cc3)cc2)c2ccc(-c3cccc4ccccc34)cc2)c([2H])c([2H])c1-c1cccc2oc3ccccc3c12 |
| InChI | InChI=1S/C60H39NO/c1-3-13-50-42(10-1)12-7-16-51(50)45-28-35-48(36-29-45)61(49-37-30-46(31-38-49)54-18-9-21-59-60(54)57-15-5-6-20-58(57)62-59)47-33-26-41(27-34-47)40-22-24-44(25-23-40)53-17-8-19-55-52-14-4-2-11-43(52)32-39-56(53)55/h1-39H/i30D,31D,37D,38D |
| InChIKey | JFYCCDKGNMHGOW-WEMNJEEZSA-N |
| XLogP | 17.18 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.00 |
| LogP ≤ 5 | 17.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|