C25H29ClF2N4O2 — CID 176811240
(6-chloro-7-fluoro-4-hexyl-1H-indol-2-yl)-[4-(5-fluoro-3-methoxy-2-pyridinyl)piperazin-1-yl]methanone (PubChem CID 176811240) has the molecular formula C25H29ClF2N4O2 and a molecular weight of 490.98 g/mol. Its IUPAC name is (6-chloro-7-fluoro-4-hexyl-1H-indol-2-yl)-[4-(5-fluoro-3-methoxy-2-pyridinyl)piperazin-1-yl]methanone.
| Compound Name | (6-chloro-7-fluoro-4-hexyl-1H-indol-2-yl)-[4-(5-fluoro-3-methoxy-2-pyridinyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 176811240 |
| Molecular Formula | C25H29ClF2N4O2 |
| Molecular Weight | 490.98 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | (6-chloro-7-fluoro-4-hexyl-1H-indol-2-yl)-[4-(5-fluoro-3-methoxy-2-pyridinyl)piperazin-1-yl]methanone |
| SMILES | CCCCCCc1cc(Cl)c(F)c2[nH]c(C(=O)N3CCN(c4ncc(F)cc4OC)CC3)cc12 |
| InChI | InChI=1S/C25H29ClF2N4O2/c1-3-4-5-6-7-16-12-19(26)22(28)23-18(16)14-20(30-23)25(33)32-10-8-31(9-11-32)24-21(34-2)13-17(27)15-29-24/h12-15,30H,3-11H2,1-2H3 |
| InChIKey | IHLOVMYRTOMDJX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.98 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|