C30H35N7O — CID 176811741
[1-(cyclopropylmethyl)-7-(2-ethylpyrazol-3-yl)-2-(1,2,3,6-tetrahydropyridin-5-yl)indol-5-yl]-(1-ethyl-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl)methanone (PubChem CID 176811741) has the molecular formula C30H35N7O and a molecular weight of 509.66 g/mol. Its IUPAC name is [1-(cyclopropylmethyl)-7-(2-ethylpyrazol-3-yl)-2-(1,2,3,6-tetrahydropyridin-5-yl)indol-5-yl]-(1-ethyl-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl)methanone.
| Compound Name | [1-(cyclopropylmethyl)-7-(2-ethylpyrazol-3-yl)-2-(1,2,3,6-tetrahydropyridin-5-yl)indol-5-yl]-(1-ethyl-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 176811741 |
| Molecular Formula | C30H35N7O |
| Molecular Weight | 509.66 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | [1-(cyclopropylmethyl)-7-(2-ethylpyrazol-3-yl)-2-(1,2,3,6-tetrahydropyridin-5-yl)indol-5-yl]-(1-ethyl-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl)methanone |
| SMILES | CCn1nccc1-c1cc(C(=O)N2Cc3cnn(CC)c3C2)cc2cc(C3=CCCNC3)n(CC3CC3)c12 |
| InChI | InChI=1S/C30H35N7O/c1-3-36-26(9-11-32-36)25-13-23(30(38)34-18-24-16-33-37(4-2)28(24)19-34)12-22-14-27(21-6-5-10-31-15-21)35(29(22)25)17-20-7-8-20/h6,9,11-14,16,20,31H,3-5,7-8,10,15,17-19H2,1-2H3 |
| InChIKey | UZXQTQWEBIGEGH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.66 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|