About 1-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole;hydrochloride
1-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole;hydrochloride (PubChem CID 176811769) has the molecular formula C7H12ClN3
and a molecular weight of 173.65 g/mol. Its IUPAC name is 1-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole;hydrochloride.
Molecular Properties
| Compound Name | 1-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole;hydrochloride |
| PubChem CID | 176811769 |
| Molecular Formula | C7H12ClN3 |
| Molecular Weight | 173.65 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 1-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole;hydrochloride |
| SMILES | CCn1ncc2c1CNC2.Cl |
| InChI | InChI=1S/C7H11N3.ClH/c1-2-10-7-5-8-3-6(7)4-9-10;/h4,8H,2-3,5H2,1H3;1H |
| InChIKey | DXFPJEKOPDLYRO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.65 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole;hydrochloride?
The IUPAC name of 1-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole;hydrochloride (CID 176811769) is 1-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole;hydrochloride.
What is the SMILES notation for 1-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole;hydrochloride?
The canonical SMILES for 1-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole;hydrochloride is CCn1ncc2c1CNC2.Cl.
What is the InChIKey of 1-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole;hydrochloride?
The InChIKey is DXFPJEKOPDLYRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3.ClH/c1-2-10-7-5-8-3-6(7)4-9-10;/h4,8H,2-3,5H2,1H3;1H.
What are the key properties of 1-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole;hydrochloride?
1-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole;hydrochloride has a molecular weight of 173.65 g/mol, XLogP of 0.93, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazole;hydrochloride is sourced from PubChem (CID 176811769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).