About CID 176812279
CID 176812279 (PubChem CID 176812279) has the molecular formula C61H57F3N4OPt
and a molecular weight of 1114.23 g/mol.
Molecular Properties
| Compound Name | CID 176812279 |
| PubChem CID | 176812279 |
| Molecular Formula | C61H57F3N4OPt |
| Molecular Weight | 1114.23 g/mol |
| Exact Mass | 1113.41 |
| IUPAC Name | — |
| SMILES | CC(C)(C)Cc1cc2c3c(ncnc3c1)-c1[c-]c(-c3cccc4c3nc(-c3[c-]c(C(C)(C)C)cc(C(C)(C)C)c3)n4-c3ccc(C(C)(C)C)cc3-c3ccccc3)c3cc(C(F)(F)F)ccc3c1O2.[Pt+2] |
| InChI | InChI=1S/C61H57F3N4O.Pt/c1-57(2,3)33-35-25-48-52-51(26-35)69-55-43-23-21-39(61(62,63)64)31-45(43)46(32-47(55)54(52)66-34-65-48)42-19-16-20-50-53(42)67-56(37-27-40(59(7,8)9)29-41(28-37)60(10,11)12)68(50)49-24-22-38(58(4,5)6)30-44(49)36-17-14-13-15-18-36;/h13-27,29-31,34H,33H2,1-12H3;/q-2;+2 |
| InChIKey | XHMDVRSPADZJCM-UHFFFAOYSA-N |
| XLogP | 16.99 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 70 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1114.23 |
| LogP ≤ 5 | 16.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 176812279 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176812279?
The IUPAC name of CID 176812279 (CID 176812279) is not available.
What is the SMILES notation for CID 176812279?
The canonical SMILES for CID 176812279 is CC(C)(C)Cc1cc2c3c(ncnc3c1)-c1[c-]c(-c3cccc4c3nc(-c3[c-]c(C(C)(C)C)cc(C(C)(C)C)c3)n4-c3ccc(C(C)(C)C)cc3-c3ccccc3)c3cc(C(F)(F)F)ccc3c1O2.[Pt+2].
What is the InChIKey of CID 176812279?
The InChIKey is XHMDVRSPADZJCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C61H57F3N4O.Pt/c1-57(2,3)33-35-25-48-52-51(26-35)69-55-43-23-21-39(61(62,63)64)31-45(43)46(32-47(55)54(52)66-34-65-48)42-19-16-20-50-53(42)67-56(37-27-40(59(7,8)9)29-41(28-37)60(10,11)12)68(50)49-24-22-38(58(4,5)6)30-44(49)36-17-14-13-15-18-36;/h13-27,29-31,34H,33H2,1-12H3;/q-2;+2.
What are the key properties of CID 176812279?
CID 176812279 has a molecular weight of 1114.23 g/mol, XLogP of 16.99, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176812279 is sourced from PubChem (CID 176812279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).