About 9-methoxy-3-methyl-2,3-dihydroimidazo[1,2-c]quinazoline
9-methoxy-3-methyl-2,3-dihydroimidazo[1,2-c]quinazoline (PubChem CID 176812854) has the molecular formula C12H13N3O
and a molecular weight of 215.26 g/mol. Its IUPAC name is 9-methoxy-3-methyl-2,3-dihydroimidazo[1,2-c]quinazoline.
Molecular Properties
| Compound Name | 9-methoxy-3-methyl-2,3-dihydroimidazo[1,2-c]quinazoline |
| PubChem CID | 176812854 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 9-methoxy-3-methyl-2,3-dihydroimidazo[1,2-c]quinazoline |
| SMILES | COc1ccc2c(c1)C1=NCC(C)N1C=N2 |
| InChI | InChI=1S/C12H13N3O/c1-8-6-13-12-10-5-9(16-2)3-4-11(10)14-7-15(8)12/h3-5,7-8H,6H2,1-2H3 |
| InChIKey | XPAAZVWWEXZHJO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-methoxy-3-methyl-2,3-dihydroimidazo[1,2-c]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methoxy-3-methyl-2,3-dihydroimidazo[1,2-c]quinazoline?
The IUPAC name of 9-methoxy-3-methyl-2,3-dihydroimidazo[1,2-c]quinazoline (CID 176812854) is 9-methoxy-3-methyl-2,3-dihydroimidazo[1,2-c]quinazoline.
What is the SMILES notation for 9-methoxy-3-methyl-2,3-dihydroimidazo[1,2-c]quinazoline?
The canonical SMILES for 9-methoxy-3-methyl-2,3-dihydroimidazo[1,2-c]quinazoline is COc1ccc2c(c1)C1=NCC(C)N1C=N2.
What is the InChIKey of 9-methoxy-3-methyl-2,3-dihydroimidazo[1,2-c]quinazoline?
The InChIKey is XPAAZVWWEXZHJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O/c1-8-6-13-12-10-5-9(16-2)3-4-11(10)14-7-15(8)12/h3-5,7-8H,6H2,1-2H3.
What are the key properties of 9-methoxy-3-methyl-2,3-dihydroimidazo[1,2-c]quinazoline?
9-methoxy-3-methyl-2,3-dihydroimidazo[1,2-c]quinazoline has a molecular weight of 215.26 g/mol, XLogP of 1.82, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxy-3-methyl-2,3-dihydroimidazo[1,2-c]quinazoline is sourced from PubChem (CID 176812854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).