C13H19F2N5O2 — CID 176814262
(2R)-2-amino-5-(diaminomethylideneamino)-N-[(2,6-difluoro-4-hydroxyphenyl)methyl]pentanamide (PubChem CID 176814262) has the molecular formula C13H19F2N5O2 and a molecular weight of 315.32 g/mol. Its IUPAC name is (2R)-2-amino-5-(diaminomethylideneamino)-N-[(2,6-difluoro-4-hydroxyphenyl)methyl]pentanamide.
| Compound Name | (2R)-2-amino-5-(diaminomethylideneamino)-N-[(2,6-difluoro-4-hydroxyphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 176814262 |
| Molecular Formula | C13H19F2N5O2 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | (2R)-2-amino-5-(diaminomethylideneamino)-N-[(2,6-difluoro-4-hydroxyphenyl)methyl]pentanamide |
| SMILES | NC(N)=NCCC[C@@H](N)C(=O)NCc1c(F)cc(O)cc1F |
| InChI | InChI=1S/C13H19F2N5O2/c14-9-4-7(21)5-10(15)8(9)6-20-12(22)11(16)2-1-3-19-13(17)18/h4-5,11,21H,1-3,6,16H2,(H,20,22)(H4,17,18,19)/t11-/m1/s1 |
| InChIKey | NOVKZWRYSKQWJY-LLVKDONJSA-N |
| XLogP | -0.33 |
| TPSA | 139.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|