C46H38N2S — CID 176814821
1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[17-(trideuteriomethyl)-10-thiapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14(19),15,17,20-decaen-8-yl]benzimidazole (PubChem CID 176814821) has the molecular formula C46H38N2S and a molecular weight of 653.91 g/mol. Its IUPAC name is 1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[17-(trideuteriomethyl)-10-thiapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14(19),15,17,20-decaen-8-yl]benzimidazole.
| Compound Name | 1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[17-(trideuteriomethyl)-10-thiapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14(19),15,17,20-decaen-8-yl]benzimidazole |
|---|---|
| PubChem CID | 176814821 |
| Molecular Formula | C46H38N2S |
| Molecular Weight | 653.91 g/mol |
| Exact Mass | 653.29 |
| IUPAC Name | 1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[17-(trideuteriomethyl)-10-thiapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14(19),15,17,20-decaen-8-yl]benzimidazole |
| SMILES | [2H]C([2H])([2H])c1ccc2c(ccc3cc4c(cc32)sc2c(-c3nc5ccccc5n3-c3c(C(C)C)cc(-c5ccccc5)cc3C(C)C)cccc24)c1 |
| InChI | InChI=1S/C46H38N2S/c1-27(2)37-24-33(30-12-7-6-8-13-30)25-38(28(3)4)44(37)48-42-17-10-9-16-41(42)47-46(48)36-15-11-14-35-40-23-32-20-19-31-22-29(5)18-21-34(31)39(32)26-43(40)49-45(35)36/h6-28H,1-5H3/i5D3 |
| InChIKey | BINKAPYNHGPWAE-VPYROQPTSA-N |
| XLogP | 13.59 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.91 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|