C36H22O — CID 176815556
1,2,3,4-tetradeuterio-8-[10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)anthracen-9-yl]dibenzofuran (PubChem CID 176815556) has the molecular formula C36H22O and a molecular weight of 481.64 g/mol. Its IUPAC name is 1,2,3,4-tetradeuterio-8-[10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)anthracen-9-yl]dibenzofuran.
| Compound Name | 1,2,3,4-tetradeuterio-8-[10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)anthracen-9-yl]dibenzofuran |
|---|---|
| PubChem CID | 176815556 |
| Molecular Formula | C36H22O |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 1,2,3,4-tetradeuterio-8-[10-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)anthracen-9-yl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3ccc(-c4c5ccccc5c(-c5c([2H])c([2H])c([2H])c6c([2H])c([2H])c([2H])c([2H])c56)c5ccccc45)cc32)c1[2H] |
| InChI | InChI=1S/C36H22O/c1-2-12-25-23(10-1)11-9-18-27(25)36-30-16-5-3-14-28(30)35(29-15-4-6-17-31(29)36)24-20-21-34-32(22-24)26-13-7-8-19-33(26)37-34/h1-22H/i1D,2D,7D,8D,9D,10D,11D,12D,13D,18D,19D |
| InChIKey | CRZYXFMREXNDDR-NUUUODFBSA-N |
| XLogP | 10.38 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|