C30H33N7O7 — CID 176815772
1-O-tert-butyl 2-O-methyl 6-[[4-[2-methanimidoyl-5-nitro-3-(oxan-2-ylamino)phenyl]triazol-1-yl]methyl]indole-1,2-dicarboxylate (PubChem CID 176815772) has the molecular formula C30H33N7O7 and a molecular weight of 603.64 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl 6-[[4-[2-methanimidoyl-5-nitro-3-(oxan-2-ylamino)phenyl]triazol-1-yl]methyl]indole-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl 6-[[4-[2-methanimidoyl-5-nitro-3-(oxan-2-ylamino)phenyl]triazol-1-yl]methyl]indole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 176815772 |
| Molecular Formula | C30H33N7O7 |
| Molecular Weight | 603.64 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl 6-[[4-[2-methanimidoyl-5-nitro-3-(oxan-2-ylamino)phenyl]triazol-1-yl]methyl]indole-1,2-dicarboxylate |
| SMILES | [H]/N=C/c1c(NC2CCCCO2)cc([N+](=O)[O-])cc1-c1cn(Cc2ccc3cc(C(=O)OC)n(C(=O)OC(C)(C)C)c3c2)nn1 |
| InChI | InChI=1S/C30H33N7O7/c1-30(2,3)44-29(39)36-25-11-18(8-9-19(25)12-26(36)28(38)42-4)16-35-17-24(33-34-35)21-13-20(37(40)41)14-23(22(21)15-31)32-27-7-5-6-10-43-27/h8-9,11-15,17,27,31-32H,5-7,10,16H2,1-4H3/b31-15+ |
| InChIKey | HJGMEVZWBKOFAI-IBBHUPRXSA-N |
| XLogP | 5.36 |
| TPSA | 176.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.64 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|