C14H19N5 — CID 176815874
3-(1-ethyltriazol-4-yl)-5-piperidin-1-ylpyridine (PubChem CID 176815874) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 3-(1-ethyltriazol-4-yl)-5-piperidin-1-ylpyridine.
| Compound Name | 3-(1-ethyltriazol-4-yl)-5-piperidin-1-ylpyridine |
|---|---|
| PubChem CID | 176815874 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 3-(1-ethyltriazol-4-yl)-5-piperidin-1-ylpyridine |
| SMILES | CCn1cc(-c2cncc(N3CCCCC3)c2)nn1 |
| InChI | InChI=1S/C14H19N5/c1-2-19-11-14(16-17-19)12-8-13(10-15-9-12)18-6-4-3-5-7-18/h8-11H,2-7H2,1H3 |
| InChIKey | LLTUTCFRDHVYRS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |