C53H51FN2O — CID 176817407
1-[4-(3,5-ditert-butylphenyl)-2,6-di(propan-2-yl)phenyl]-7-fluoro-2-(10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaen-8-yl)benzimidazole (PubChem CID 176817407) has the molecular formula C53H51FN2O and a molecular weight of 751.00 g/mol. Its IUPAC name is 1-[4-(3,5-ditert-butylphenyl)-2,6-di(propan-2-yl)phenyl]-7-fluoro-2-(10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaen-8-yl)benzimidazole.
| Compound Name | 1-[4-(3,5-ditert-butylphenyl)-2,6-di(propan-2-yl)phenyl]-7-fluoro-2-(10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaen-8-yl)benzimidazole |
|---|---|
| PubChem CID | 176817407 |
| Molecular Formula | C53H51FN2O |
| Molecular Weight | 751.00 g/mol |
| Exact Mass | 750.40 |
| IUPAC Name | 1-[4-(3,5-ditert-butylphenyl)-2,6-di(propan-2-yl)phenyl]-7-fluoro-2-(10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaen-8-yl)benzimidazole |
| SMILES | CC(C)c1cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)C)c1-n1c(-c2cccc3c2oc2cc4c(ccc5ccccc54)cc23)nc2cccc(F)c21 |
| InChI | InChI=1S/C53H51FN2O/c1-30(2)41-26-35(34-23-36(52(5,6)7)28-37(24-34)53(8,9)10)27-42(31(3)4)48(41)56-49-45(54)19-14-20-46(49)55-51(56)40-18-13-17-39-44-25-33-22-21-32-15-11-12-16-38(32)43(33)29-47(44)57-50(39)40/h11-31H,1-10H3 |
| InChIKey | XRXVIQCIDPEURA-UHFFFAOYSA-N |
| XLogP | 15.55 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.00 |
| LogP ≤ 5 | 15.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|