C45H35N3O2 — CID 176817417
8-[1-[2,4-di(propan-2-yl)dibenzofuran-3-yl]-7-(trideuteriomethyl)benzimidazol-2-yl]-10-oxa-12-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaene (PubChem CID 176817417) has the molecular formula C45H35N3O2 and a molecular weight of 652.81 g/mol. Its IUPAC name is 8-[1-[2,4-di(propan-2-yl)dibenzofuran-3-yl]-7-(trideuteriomethyl)benzimidazol-2-yl]-10-oxa-12-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaene.
| Compound Name | 8-[1-[2,4-di(propan-2-yl)dibenzofuran-3-yl]-7-(trideuteriomethyl)benzimidazol-2-yl]-10-oxa-12-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaene |
|---|---|
| PubChem CID | 176817417 |
| Molecular Formula | C45H35N3O2 |
| Molecular Weight | 652.81 g/mol |
| Exact Mass | 652.29 |
| IUPAC Name | 8-[1-[2,4-di(propan-2-yl)dibenzofuran-3-yl]-7-(trideuteriomethyl)benzimidazol-2-yl]-10-oxa-12-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaene |
| SMILES | [2H]C([2H])([2H])c1cccc2nc(-c3cccc4c3oc3nc5c(ccc6ccccc65)cc34)n(-c3c(C(C)C)cc4c(oc5ccccc54)c3C(C)C)c12 |
| InChI | InChI=1S/C45H35N3O2/c1-24(2)33-23-34-30-15-8-9-19-37(30)49-43(34)38(25(3)4)41(33)48-40-26(5)12-10-18-36(40)46-44(48)32-17-11-16-31-35-22-28-21-20-27-13-6-7-14-29(27)39(28)47-45(35)50-42(31)32/h6-25H,1-5H3/i5D3 |
| InChIKey | XNCOHYDZUGDBJG-VPYROQPTSA-N |
| XLogP | 12.75 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.81 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|