About CID 176819362
CID 176819362 (PubChem CID 176819362) has the molecular formula C17H29O3Si2
and a molecular weight of 337.59 g/mol.
Molecular Properties
| Compound Name | CID 176819362 |
| PubChem CID | 176819362 |
| Molecular Formula | C17H29O3Si2 |
| Molecular Weight | 337.59 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | — |
| SMILES | C#CC(C)(CC(C)C)O[Si]C[Si](O)OC(C)(C#C)CC(C)C |
| InChI | InChI=1S/C17H29O3Si2/c1-9-16(7,11-14(3)4)19-21-13-22(18)20-17(8,10-2)12-15(5)6/h1-2,14-15,18H,11-13H2,3-8H3 |
| InChIKey | ODWLPUUSQOCYIX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.59 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 176819362 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176819362?
The IUPAC name of CID 176819362 (CID 176819362) is not available.
What is the SMILES notation for CID 176819362?
The canonical SMILES for CID 176819362 is C#CC(C)(CC(C)C)O[Si]C[Si](O)OC(C)(C#C)CC(C)C.
What is the InChIKey of CID 176819362?
The InChIKey is ODWLPUUSQOCYIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29O3Si2/c1-9-16(7,11-14(3)4)19-21-13-22(18)20-17(8,10-2)12-15(5)6/h1-2,14-15,18H,11-13H2,3-8H3.
What are the key properties of CID 176819362?
CID 176819362 has a molecular weight of 337.59 g/mol, XLogP of 2.95, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176819362 is sourced from PubChem (CID 176819362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).