C26H37O5Si2 — CID 176819384
CID 176819384 (PubChem CID 176819384) has the molecular formula C26H37O5Si2 and a molecular weight of 485.75 g/mol.
| Compound Name | CID 176819384 |
|---|---|
| PubChem CID | 176819384 |
| Molecular Formula | C26H37O5Si2 |
| Molecular Weight | 485.75 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | — |
| SMILES | C#CC(C)(C)O[Si](C[Si](OC(C)(C)C#C)(OC(C)(C)C#C)OC(C)(C)C#C)OC(C)(C)C#C |
| InChI | InChI=1S/C26H37O5Si2/c1-16-22(6,7)27-32(28-23(8,9)17-2)21-33(29-24(10,11)18-3,30-25(12,13)19-4)31-26(14,15)20-5/h1-5H,21H2,6-15H3 |
| InChIKey | OKDDUSWGUVDBBH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.75 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|