C11H19F2NO — CID 176821603
1-(2,2-difluoropropyl)-5-propan-2-ylpiperidin-2-one (PubChem CID 176821603) has the molecular formula C11H19F2NO and a molecular weight of 219.27 g/mol. Its IUPAC name is 1-(2,2-difluoropropyl)-5-propan-2-ylpiperidin-2-one.
| Compound Name | 1-(2,2-difluoropropyl)-5-propan-2-ylpiperidin-2-one |
|---|---|
| PubChem CID | 176821603 |
| Molecular Formula | C11H19F2NO |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 1-(2,2-difluoropropyl)-5-propan-2-ylpiperidin-2-one |
| SMILES | CC(C)C1CCC(=O)N(CC(C)(F)F)C1 |
| InChI | InChI=1S/C11H19F2NO/c1-8(2)9-4-5-10(15)14(6-9)7-11(3,12)13/h8-9H,4-7H2,1-3H3 |
| InChIKey | JBFQHKBZXCTMRB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |