C45H37N3O — CID 176823580
5-[1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]-12-(trideuteriomethyl)-3-oxa-11-azapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,11,13,15,17,19-decaene (PubChem CID 176823580) has the molecular formula C45H37N3O and a molecular weight of 638.83 g/mol. Its IUPAC name is 5-[1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]-12-(trideuteriomethyl)-3-oxa-11-azapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,11,13,15,17,19-decaene.
| Compound Name | 5-[1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]-12-(trideuteriomethyl)-3-oxa-11-azapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 176823580 |
| Molecular Formula | C45H37N3O |
| Molecular Weight | 638.83 g/mol |
| Exact Mass | 638.31 |
| IUPAC Name | 5-[1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]-12-(trideuteriomethyl)-3-oxa-11-azapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,11,13,15,17,19-decaene |
| SMILES | [2H]C([2H])([2H])c1nc2c3cccc(-c4nc5ccccc5n4-c4c(C(C)C)cc(-c5ccccc5)cc4C(C)C)c3oc2c2cc3ccccc3cc12 |
| InChI | InChI=1S/C45H37N3O/c1-26(2)35-24-32(29-14-7-6-8-15-29)25-36(27(3)4)42(35)48-40-21-12-11-20-39(40)47-45(48)34-19-13-18-33-41-44(49-43(33)34)38-23-31-17-10-9-16-30(31)22-37(38)28(5)46-41/h6-27H,1-5H3/i5D3 |
| InChIKey | YIPYJQZYGJPFLQ-VPYROQPTSA-N |
| XLogP | 12.52 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.83 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|