C22H21F3N8O2 — CID 176827440
4-[10-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-7-yl]-1,4-oxazepan-5-one (PubChem CID 176827440) has the molecular formula C22H21F3N8O2 and a molecular weight of 486.46 g/mol. Its IUPAC name is 4-[10-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-7-yl]-1,4-oxazepan-5-one.
| Compound Name | 4-[10-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-7-yl]-1,4-oxazepan-5-one |
|---|---|
| PubChem CID | 176827440 |
| Molecular Formula | C22H21F3N8O2 |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 4-[10-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-7-yl]-1,4-oxazepan-5-one |
| SMILES | C[C@@H](Nc1ncnc2c1cc(N1CCOCCC1=O)c1nncn12)c1cc(N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H21F3N8O2/c1-12(13-6-14(22(23,24)25)8-15(26)7-13)30-19-16-9-17(32-3-5-35-4-2-18(32)34)21-31-29-11-33(21)20(16)28-10-27-19/h6-12H,2-5,26H2,1H3,(H,27,28,30)/t12-/m1/s1 |
| InChIKey | MDGRBZJBPHYZGV-GFCCVEGCSA-N |
| XLogP | 3.20 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|