About 1-[(2R,3S)-2-methyl-1-prop-2-enoylpyrrolidin-3-yl]-5-propan-2-ylpyridin-2-one
1-[(2R,3S)-2-methyl-1-prop-2-enoylpyrrolidin-3-yl]-5-propan-2-ylpyridin-2-one (PubChem CID 176827556) has the molecular formula C16H22N2O2
and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-[(2R,3S)-2-methyl-1-prop-2-enoylpyrrolidin-3-yl]-5-propan-2-ylpyridin-2-one.
Molecular Properties
| Compound Name | 1-[(2R,3S)-2-methyl-1-prop-2-enoylpyrrolidin-3-yl]-5-propan-2-ylpyridin-2-one |
| PubChem CID | 176827556 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-[(2R,3S)-2-methyl-1-prop-2-enoylpyrrolidin-3-yl]-5-propan-2-ylpyridin-2-one |
| SMILES | C=CC(=O)N1CC[C@H](n2cc(C(C)C)ccc2=O)[C@H]1C |
| InChI | InChI=1S/C16H22N2O2/c1-5-15(19)17-9-8-14(12(17)4)18-10-13(11(2)3)6-7-16(18)20/h5-7,10-12,14H,1,8-9H2,2-4H3/t12-,14+/m1/s1 |
| InChIKey | MSTBDKWVNSRTJK-OCCSQVGLSA-N |
| XLogP | 2.32 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2R,3S)-2-methyl-1-prop-2-enoylpyrrolidin-3-yl]-5-propan-2-ylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R,3S)-2-methyl-1-prop-2-enoylpyrrolidin-3-yl]-5-propan-2-ylpyridin-2-one?
The IUPAC name of 1-[(2R,3S)-2-methyl-1-prop-2-enoylpyrrolidin-3-yl]-5-propan-2-ylpyridin-2-one (CID 176827556) is 1-[(2R,3S)-2-methyl-1-prop-2-enoylpyrrolidin-3-yl]-5-propan-2-ylpyridin-2-one.
What is the SMILES notation for 1-[(2R,3S)-2-methyl-1-prop-2-enoylpyrrolidin-3-yl]-5-propan-2-ylpyridin-2-one?
The canonical SMILES for 1-[(2R,3S)-2-methyl-1-prop-2-enoylpyrrolidin-3-yl]-5-propan-2-ylpyridin-2-one is C=CC(=O)N1CC[C@H](n2cc(C(C)C)ccc2=O)[C@H]1C.
What is the InChIKey of 1-[(2R,3S)-2-methyl-1-prop-2-enoylpyrrolidin-3-yl]-5-propan-2-ylpyridin-2-one?
The InChIKey is MSTBDKWVNSRTJK-OCCSQVGLSA-N. The full InChI is InChI=1S/C16H22N2O2/c1-5-15(19)17-9-8-14(12(17)4)18-10-13(11(2)3)6-7-16(18)20/h5-7,10-12,14H,1,8-9H2,2-4H3/t12-,14+/m1/s1.
What are the key properties of 1-[(2R,3S)-2-methyl-1-prop-2-enoylpyrrolidin-3-yl]-5-propan-2-ylpyridin-2-one?
1-[(2R,3S)-2-methyl-1-prop-2-enoylpyrrolidin-3-yl]-5-propan-2-ylpyridin-2-one has a molecular weight of 274.36 g/mol, XLogP of 2.32, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R,3S)-2-methyl-1-prop-2-enoylpyrrolidin-3-yl]-5-propan-2-ylpyridin-2-one is sourced from PubChem (CID 176827556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).