C31H27FN4O3S — CID 176827623
1-[4-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]imidazol-1-yl]prop-2-en-1-one (PubChem CID 176827623) has the molecular formula C31H27FN4O3S and a molecular weight of 554.65 g/mol. Its IUPAC name is 1-[4-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]imidazol-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]imidazol-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 176827623 |
| Molecular Formula | C31H27FN4O3S |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | 1-[4-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]imidazol-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)n1cnc(-c2nc(-c3ccc4c(c3)CCNC4)c3ccsc3c2-c2ccc(F)cc2OCCOC)c1 |
| InChI | InChI=1S/C31H27FN4O3S/c1-3-27(37)36-17-25(34-18-36)30-28(23-7-6-22(32)15-26(23)39-12-11-38-2)31-24(9-13-40-31)29(35-30)20-4-5-21-16-33-10-8-19(21)14-20/h3-7,9,13-15,17-18,33H,1,8,10-12,16H2,2H3 |
| InChIKey | ZOERJOYKUUFWRQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|