About [4-[(4-methylphenyl)methoxy]phenyl]methyl (2R)-2-aminopropanoate
[4-[(4-methylphenyl)methoxy]phenyl]methyl (2R)-2-aminopropanoate (PubChem CID 176827947) has the molecular formula C18H21NO3
and a molecular weight of 299.37 g/mol. Its IUPAC name is [4-[(4-methylphenyl)methoxy]phenyl]methyl (2R)-2-aminopropanoate.
Molecular Properties
| Compound Name | [4-[(4-methylphenyl)methoxy]phenyl]methyl (2R)-2-aminopropanoate |
| PubChem CID | 176827947 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | [4-[(4-methylphenyl)methoxy]phenyl]methyl (2R)-2-aminopropanoate |
| SMILES | Cc1ccc(COc2ccc(COC(=O)[C@@H](C)N)cc2)cc1 |
| InChI | InChI=1S/C18H21NO3/c1-13-3-5-15(6-4-13)11-21-17-9-7-16(8-10-17)12-22-18(20)14(2)19/h3-10,14H,11-12,19H2,1-2H3/t14-/m1/s1 |
| InChIKey | VXBYKHADLGZADO-CQSZACIVSA-N |
| XLogP | 2.96 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[(4-methylphenyl)methoxy]phenyl]methyl (2R)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4-methylphenyl)methoxy]phenyl]methyl (2R)-2-aminopropanoate?
The IUPAC name of [4-[(4-methylphenyl)methoxy]phenyl]methyl (2R)-2-aminopropanoate (CID 176827947) is [4-[(4-methylphenyl)methoxy]phenyl]methyl (2R)-2-aminopropanoate.
What is the SMILES notation for [4-[(4-methylphenyl)methoxy]phenyl]methyl (2R)-2-aminopropanoate?
The canonical SMILES for [4-[(4-methylphenyl)methoxy]phenyl]methyl (2R)-2-aminopropanoate is Cc1ccc(COc2ccc(COC(=O)[C@@H](C)N)cc2)cc1.
What is the InChIKey of [4-[(4-methylphenyl)methoxy]phenyl]methyl (2R)-2-aminopropanoate?
The InChIKey is VXBYKHADLGZADO-CQSZACIVSA-N. The full InChI is InChI=1S/C18H21NO3/c1-13-3-5-15(6-4-13)11-21-17-9-7-16(8-10-17)12-22-18(20)14(2)19/h3-10,14H,11-12,19H2,1-2H3/t14-/m1/s1.
What are the key properties of [4-[(4-methylphenyl)methoxy]phenyl]methyl (2R)-2-aminopropanoate?
[4-[(4-methylphenyl)methoxy]phenyl]methyl (2R)-2-aminopropanoate has a molecular weight of 299.37 g/mol, XLogP of 2.96, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4-methylphenyl)methoxy]phenyl]methyl (2R)-2-aminopropanoate is sourced from PubChem (CID 176827947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).