C39H46O7Si — CID 176829173
methoxymethyl 3-ethyl-4-[2-hydroxy-4-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]-3,6-dimethylbenzoyl]oxy-2,5,6-trimethylbenzoate (PubChem CID 176829173) has the molecular formula C39H46O7Si and a molecular weight of 654.88 g/mol. Its IUPAC name is methoxymethyl 3-ethyl-4-[2-hydroxy-4-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]-3,6-dimethylbenzoyl]oxy-2,5,6-trimethylbenzoate.
| Compound Name | methoxymethyl 3-ethyl-4-[2-hydroxy-4-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]-3,6-dimethylbenzoyl]oxy-2,5,6-trimethylbenzoate |
|---|---|
| PubChem CID | 176829173 |
| Molecular Formula | C39H46O7Si |
| Molecular Weight | 654.88 g/mol |
| Exact Mass | 654.30 |
| IUPAC Name | methoxymethyl 3-ethyl-4-[2-hydroxy-4-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]-3,6-dimethylbenzoyl]oxy-2,5,6-trimethylbenzoate |
| SMILES | CCc1c(C)c(C(=O)OCOC)c(C)c(C)c1OC(=O)c1c(C)cc(CC(C)(C)[Si](O)(c2ccccc2)c2ccccc2)c(C)c1O |
| InChI | InChI=1S/C39H46O7Si/c1-10-32-28(6)34(37(41)45-23-44-9)25(3)26(4)36(32)46-38(42)33-24(2)21-29(27(5)35(33)40)22-39(7,8)47(43,30-17-13-11-14-18-30)31-19-15-12-16-20-31/h11-21,40,43H,10,22-23H2,1-9H3 |
| InChIKey | OMDWAJLBTOPXGT-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.88 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|