About 9-fluoro-3,10,11-tri(propan-2-yl)-3-azaspiro[5.5]undec-10-ene
9-fluoro-3,10,11-tri(propan-2-yl)-3-azaspiro[5.5]undec-10-ene (PubChem CID 176829800) has the molecular formula C19H34FN
and a molecular weight of 295.49 g/mol. Its IUPAC name is 9-fluoro-3,10,11-tri(propan-2-yl)-3-azaspiro[5.5]undec-10-ene.
Molecular Properties
| Compound Name | 9-fluoro-3,10,11-tri(propan-2-yl)-3-azaspiro[5.5]undec-10-ene |
| PubChem CID | 176829800 |
| Molecular Formula | C19H34FN |
| Molecular Weight | 295.49 g/mol |
| Exact Mass | 295.27 |
| IUPAC Name | 9-fluoro-3,10,11-tri(propan-2-yl)-3-azaspiro[5.5]undec-10-ene |
| SMILES | CC(C)C1=C(C(C)C)C2(CCC1F)CCN(C(C)C)CC2 |
| InChI | InChI=1S/C19H34FN/c1-13(2)17-16(20)7-8-19(18(17)14(3)4)9-11-21(12-10-19)15(5)6/h13-16H,7-12H2,1-6H3 |
| InChIKey | BFJPOOHWTZTWHI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-fluoro-3,10,11-tri(propan-2-yl)-3-azaspiro[5.5]undec-10-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-fluoro-3,10,11-tri(propan-2-yl)-3-azaspiro[5.5]undec-10-ene?
The IUPAC name of 9-fluoro-3,10,11-tri(propan-2-yl)-3-azaspiro[5.5]undec-10-ene (CID 176829800) is 9-fluoro-3,10,11-tri(propan-2-yl)-3-azaspiro[5.5]undec-10-ene.
What is the SMILES notation for 9-fluoro-3,10,11-tri(propan-2-yl)-3-azaspiro[5.5]undec-10-ene?
The canonical SMILES for 9-fluoro-3,10,11-tri(propan-2-yl)-3-azaspiro[5.5]undec-10-ene is CC(C)C1=C(C(C)C)C2(CCC1F)CCN(C(C)C)CC2.
What is the InChIKey of 9-fluoro-3,10,11-tri(propan-2-yl)-3-azaspiro[5.5]undec-10-ene?
The InChIKey is BFJPOOHWTZTWHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34FN/c1-13(2)17-16(20)7-8-19(18(17)14(3)4)9-11-21(12-10-19)15(5)6/h13-16H,7-12H2,1-6H3.
What are the key properties of 9-fluoro-3,10,11-tri(propan-2-yl)-3-azaspiro[5.5]undec-10-ene?
9-fluoro-3,10,11-tri(propan-2-yl)-3-azaspiro[5.5]undec-10-ene has a molecular weight of 295.49 g/mol, XLogP of 5.22, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-fluoro-3,10,11-tri(propan-2-yl)-3-azaspiro[5.5]undec-10-ene is sourced from PubChem (CID 176829800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).