About 2-fluoro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene
2-fluoro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene (PubChem CID 176829939) has the molecular formula C18H32FN
and a molecular weight of 281.46 g/mol. Its IUPAC name is 2-fluoro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene.
Molecular Properties
| Compound Name | 2-fluoro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene |
| PubChem CID | 176829939 |
| Molecular Formula | C18H32FN |
| Molecular Weight | 281.46 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | 2-fluoro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene |
| SMILES | CC(C)C1=C(C(C)C)C2(CCN(C(C)C)CC2)CC1F |
| InChI | InChI=1S/C18H32FN/c1-12(2)16-15(19)11-18(17(16)13(3)4)7-9-20(10-8-18)14(5)6/h12-15H,7-11H2,1-6H3 |
| InChIKey | NQGJPAOEGWXUCV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene?
The IUPAC name of 2-fluoro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene (CID 176829939) is 2-fluoro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene.
What is the SMILES notation for 2-fluoro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene?
The canonical SMILES for 2-fluoro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene is CC(C)C1=C(C(C)C)C2(CCN(C(C)C)CC2)CC1F.
What is the InChIKey of 2-fluoro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene?
The InChIKey is NQGJPAOEGWXUCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32FN/c1-12(2)16-15(19)11-18(17(16)13(3)4)7-9-20(10-8-18)14(5)6/h12-15H,7-11H2,1-6H3.
What are the key properties of 2-fluoro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene?
2-fluoro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene has a molecular weight of 281.46 g/mol, XLogP of 4.83, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3,4,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-3-ene is sourced from PubChem (CID 176829939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).