C19H32FN — CID 176830000
(1S,3'R,4S,5R)-3'-fluoro-1',2,3-tri(propan-2-yl)spiro[bicyclo[3.1.0]hex-2-ene-4,4'-piperidine] (PubChem CID 176830000) has the molecular formula C19H32FN and a molecular weight of 293.47 g/mol. Its IUPAC name is (1S,3'R,4S,5R)-3'-fluoro-1',2,3-tri(propan-2-yl)spiro[bicyclo[3.1.0]hex-2-ene-4,4'-piperidine].
| Compound Name | (1S,3'R,4S,5R)-3'-fluoro-1',2,3-tri(propan-2-yl)spiro[bicyclo[3.1.0]hex-2-ene-4,4'-piperidine] |
|---|---|
| PubChem CID | 176830000 |
| Molecular Formula | C19H32FN |
| Molecular Weight | 293.47 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | (1S,3'R,4S,5R)-3'-fluoro-1',2,3-tri(propan-2-yl)spiro[bicyclo[3.1.0]hex-2-ene-4,4'-piperidine] |
| SMILES | CC(C)C1=C(C(C)C)[C@]2(CCN(C(C)C)C[C@@H]2F)[C@@H]2C[C@H]12 |
| InChI | InChI=1S/C19H32FN/c1-11(2)17-14-9-15(14)19(18(17)12(3)4)7-8-21(13(5)6)10-16(19)20/h11-16H,7-10H2,1-6H3/t14-,15+,16-,19+/m0/s1 |
| InChIKey | VKHNAZJDVPTZLA-CYJAXWMASA-N |
| XLogP | 4.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|