C45H30N4 — CID 176831267
9-[4-(3-phenylphenyl)-6-[3-(4-phenylphenyl)phenyl]-1,3,5-triazin-2-yl]carbazole (PubChem CID 176831267) has the molecular formula C45H30N4 and a molecular weight of 626.76 g/mol. Its IUPAC name is 9-[4-(3-phenylphenyl)-6-[3-(4-phenylphenyl)phenyl]-1,3,5-triazin-2-yl]carbazole.
| Compound Name | 9-[4-(3-phenylphenyl)-6-[3-(4-phenylphenyl)phenyl]-1,3,5-triazin-2-yl]carbazole |
|---|---|
| PubChem CID | 176831267 |
| Molecular Formula | C45H30N4 |
| Molecular Weight | 626.76 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | 9-[4-(3-phenylphenyl)-6-[3-(4-phenylphenyl)phenyl]-1,3,5-triazin-2-yl]carbazole |
| SMILES | c1ccc(-c2ccc(-c3cccc(-c4nc(-c5cccc(-c6ccccc6)c5)nc(-n5c6ccccc6c6ccccc65)n4)c3)cc2)cc1 |
| InChI | InChI=1S/C45H30N4/c1-3-13-31(14-4-1)33-25-27-34(28-26-33)36-18-12-20-38(30-36)44-46-43(37-19-11-17-35(29-37)32-15-5-2-6-16-32)47-45(48-44)49-41-23-9-7-21-39(41)40-22-8-10-24-42(40)49/h1-30H |
| InChIKey | XOUZEWAUEQOPQF-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.76 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |