C53H43N5O — CID 176831619
2-[4-[2-(2,6-diphenylphenyl)-1H-imidazo[1,5-a]quinoxalin-2-ium-1-id-8-yl]-1-[2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]phenol (PubChem CID 176831619) has the molecular formula C53H43N5O and a molecular weight of 765.96 g/mol. Its IUPAC name is 2-[4-[2-(2,6-diphenylphenyl)-1H-imidazo[1,5-a]quinoxalin-2-ium-1-id-8-yl]-1-[2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]phenol.
| Compound Name | 2-[4-[2-(2,6-diphenylphenyl)-1H-imidazo[1,5-a]quinoxalin-2-ium-1-id-8-yl]-1-[2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]phenol |
|---|---|
| PubChem CID | 176831619 |
| Molecular Formula | C53H43N5O |
| Molecular Weight | 765.96 g/mol |
| Exact Mass | 765.35 |
| IUPAC Name | 2-[4-[2-(2,6-diphenylphenyl)-1H-imidazo[1,5-a]quinoxalin-2-ium-1-id-8-yl]-1-[2,6-di(propan-2-yl)phenyl]benzimidazol-2-yl]phenol |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(-c2ccccc2O)nc2c(-c3ccc4ncc5c[n+](-c6c(-c7ccccc7)cccc6-c6ccccc6)[c-]n5c4c3)cccc21 |
| InChI | InChI=1S/C53H43N5O/c1-34(2)40-21-13-22-41(35(3)4)52(40)58-47-26-15-23-42(50(47)55-53(58)45-20-11-12-27-49(45)59)38-28-29-46-48(30-38)57-33-56(32-39(57)31-54-46)51-43(36-16-7-5-8-17-36)24-14-25-44(51)37-18-9-6-10-19-37/h5-32,34-35,59H,1-4H3 |
| InChIKey | NSYXSOIGHZSPGS-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 59.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.96 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|