C17H21ClO2S — CID 176831774
1-[(2E)-2-[(Z)-2-chloroethenyl]-6-methylhepta-2,5-dienyl]sulfonyl-4-methylbenzene (PubChem CID 176831774) has the molecular formula C17H21ClO2S and a molecular weight of 324.87 g/mol. Its IUPAC name is 1-[(2E)-2-[(Z)-2-chloroethenyl]-6-methylhepta-2,5-dienyl]sulfonyl-4-methylbenzene.
| Compound Name | 1-[(2E)-2-[(Z)-2-chloroethenyl]-6-methylhepta-2,5-dienyl]sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 176831774 |
| Molecular Formula | C17H21ClO2S |
| Molecular Weight | 324.87 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 1-[(2E)-2-[(Z)-2-chloroethenyl]-6-methylhepta-2,5-dienyl]sulfonyl-4-methylbenzene |
| SMILES | CC(C)=CC/C=C(\C=C/Cl)CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H21ClO2S/c1-14(2)5-4-6-16(11-12-18)13-21(19,20)17-9-7-15(3)8-10-17/h5-12H,4,13H2,1-3H3/b12-11-,16-6+ |
| InChIKey | KUACVXYHQGAYLM-CDIOEGICSA-N |
| XLogP | 4.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.87 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|