About 2-[(E)-5,6-dihydrocyclopenta[b]thiophen-4-ylidenemethyl]-1-methylpyrrolidine
2-[(E)-5,6-dihydrocyclopenta[b]thiophen-4-ylidenemethyl]-1-methylpyrrolidine (PubChem CID 176832174) has the molecular formula C13H17NS
and a molecular weight of 219.35 g/mol. Its IUPAC name is 2-[(E)-5,6-dihydrocyclopenta[b]thiophen-4-ylidenemethyl]-1-methylpyrrolidine.
Molecular Properties
| Compound Name | 2-[(E)-5,6-dihydrocyclopenta[b]thiophen-4-ylidenemethyl]-1-methylpyrrolidine |
| PubChem CID | 176832174 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 2-[(E)-5,6-dihydrocyclopenta[b]thiophen-4-ylidenemethyl]-1-methylpyrrolidine |
| SMILES | CN1CCCC1/C=C1\CCc2sccc21 |
| InChI | InChI=1S/C13H17NS/c1-14-7-2-3-11(14)9-10-4-5-13-12(10)6-8-15-13/h6,8-9,11H,2-5,7H2,1H3/b10-9+ |
| InChIKey | IIVYLWCSZLZGSZ-MDZDMXLPSA-N |
| XLogP | 3.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(E)-5,6-dihydrocyclopenta[b]thiophen-4-ylidenemethyl]-1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-5,6-dihydrocyclopenta[b]thiophen-4-ylidenemethyl]-1-methylpyrrolidine?
The IUPAC name of 2-[(E)-5,6-dihydrocyclopenta[b]thiophen-4-ylidenemethyl]-1-methylpyrrolidine (CID 176832174) is 2-[(E)-5,6-dihydrocyclopenta[b]thiophen-4-ylidenemethyl]-1-methylpyrrolidine.
What is the SMILES notation for 2-[(E)-5,6-dihydrocyclopenta[b]thiophen-4-ylidenemethyl]-1-methylpyrrolidine?
The canonical SMILES for 2-[(E)-5,6-dihydrocyclopenta[b]thiophen-4-ylidenemethyl]-1-methylpyrrolidine is CN1CCCC1/C=C1\CCc2sccc21.
What is the InChIKey of 2-[(E)-5,6-dihydrocyclopenta[b]thiophen-4-ylidenemethyl]-1-methylpyrrolidine?
The InChIKey is IIVYLWCSZLZGSZ-MDZDMXLPSA-N. The full InChI is InChI=1S/C13H17NS/c1-14-7-2-3-11(14)9-10-4-5-13-12(10)6-8-15-13/h6,8-9,11H,2-5,7H2,1H3/b10-9+.
What are the key properties of 2-[(E)-5,6-dihydrocyclopenta[b]thiophen-4-ylidenemethyl]-1-methylpyrrolidine?
2-[(E)-5,6-dihydrocyclopenta[b]thiophen-4-ylidenemethyl]-1-methylpyrrolidine has a molecular weight of 219.35 g/mol, XLogP of 3.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-5,6-dihydrocyclopenta[b]thiophen-4-ylidenemethyl]-1-methylpyrrolidine is sourced from PubChem (CID 176832174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).