C26H42Cl2F2N6O3S — CID 176833287
N-[5-[3-chloro-5-(difluoromethyl)-6-methylpiperidine-2-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-4-(2-chloro-5-methoxypiperidin-4-yl)-6-methylpiperidine-3-carboxamide (PubChem CID 176833287) has the molecular formula C26H42Cl2F2N6O3S and a molecular weight of 627.63 g/mol. Its IUPAC name is N-[5-[3-chloro-5-(difluoromethyl)-6-methylpiperidine-2-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-4-(2-chloro-5-methoxypiperidin-4-yl)-6-methylpiperidine-3-carboxamide.
| Compound Name | N-[5-[3-chloro-5-(difluoromethyl)-6-methylpiperidine-2-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-4-(2-chloro-5-methoxypiperidin-4-yl)-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 176833287 |
| Molecular Formula | C26H42Cl2F2N6O3S |
| Molecular Weight | 627.63 g/mol |
| Exact Mass | 626.24 |
| IUPAC Name | N-[5-[3-chloro-5-(difluoromethyl)-6-methylpiperidine-2-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]-4-(2-chloro-5-methoxypiperidin-4-yl)-6-methylpiperidine-3-carboxamide |
| SMILES | COC1CNC(Cl)CC1C1CC(C)NCC1C(=O)NC1NC2CN(C(=O)C3NC(C)C(C(F)F)CC3Cl)CC2S1 |
| InChI | InChI=1S/C26H42Cl2F2N6O3S/c1-11-4-14(15-6-21(28)32-8-19(15)39-3)16(7-31-11)24(37)35-26-34-18-9-36(10-20(18)40-26)25(38)22-17(27)5-13(23(29)30)12(2)33-22/h11-23,26,31-34H,4-10H2,1-3H3,(H,35,37) |
| InChIKey | JQEBQUXBDIONNR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 106.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.63 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|