About 1-(5,6-dimethyldiazinan-4-yl)-2,2-dimethylpropan-1-one
1-(5,6-dimethyldiazinan-4-yl)-2,2-dimethylpropan-1-one (PubChem CID 176833828) has the molecular formula C11H22N2O
and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-(5,6-dimethyldiazinan-4-yl)-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-(5,6-dimethyldiazinan-4-yl)-2,2-dimethylpropan-1-one |
| PubChem CID | 176833828 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 1-(5,6-dimethyldiazinan-4-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC1NNCC(C(=O)C(C)(C)C)C1C |
| InChI | InChI=1S/C11H22N2O/c1-7-8(2)13-12-6-9(7)10(14)11(3,4)5/h7-9,12-13H,6H2,1-5H3 |
| InChIKey | ZWJNCDYUOAQEAE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5,6-dimethyldiazinan-4-yl)-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,6-dimethyldiazinan-4-yl)-2,2-dimethylpropan-1-one?
The IUPAC name of 1-(5,6-dimethyldiazinan-4-yl)-2,2-dimethylpropan-1-one (CID 176833828) is 1-(5,6-dimethyldiazinan-4-yl)-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-(5,6-dimethyldiazinan-4-yl)-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-(5,6-dimethyldiazinan-4-yl)-2,2-dimethylpropan-1-one is CC1NNCC(C(=O)C(C)(C)C)C1C.
What is the InChIKey of 1-(5,6-dimethyldiazinan-4-yl)-2,2-dimethylpropan-1-one?
The InChIKey is ZWJNCDYUOAQEAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O/c1-7-8(2)13-12-6-9(7)10(14)11(3,4)5/h7-9,12-13H,6H2,1-5H3.
What are the key properties of 1-(5,6-dimethyldiazinan-4-yl)-2,2-dimethylpropan-1-one?
1-(5,6-dimethyldiazinan-4-yl)-2,2-dimethylpropan-1-one has a molecular weight of 198.31 g/mol, XLogP of 1.35, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,6-dimethyldiazinan-4-yl)-2,2-dimethylpropan-1-one is sourced from PubChem (CID 176833828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).