C24H38ClN5O3S — CID 176833856
4-(2-chloro-5-methoxypiperidin-4-yl)-6-methyl-N-[5-(spiro[2.2]pentane-2-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]piperidine-3-carboxamide (PubChem CID 176833856) has the molecular formula C24H38ClN5O3S and a molecular weight of 512.12 g/mol. Its IUPAC name is 4-(2-chloro-5-methoxypiperidin-4-yl)-6-methyl-N-[5-(spiro[2.2]pentane-2-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]piperidine-3-carboxamide.
| Compound Name | 4-(2-chloro-5-methoxypiperidin-4-yl)-6-methyl-N-[5-(spiro[2.2]pentane-2-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 176833856 |
| Molecular Formula | C24H38ClN5O3S |
| Molecular Weight | 512.12 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 4-(2-chloro-5-methoxypiperidin-4-yl)-6-methyl-N-[5-(spiro[2.2]pentane-2-carbonyl)-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-d][1,3]thiazol-2-yl]piperidine-3-carboxamide |
| SMILES | COC1CNC(Cl)CC1C1CC(C)NCC1C(=O)NC1NC2CN(C(=O)C3CC34CC4)CC2S1 |
| InChI | InChI=1S/C24H38ClN5O3S/c1-12-5-13(14-6-20(25)27-9-18(14)33-2)15(8-26-12)21(31)29-23-28-17-10-30(11-19(17)34-23)22(32)16-7-24(16)3-4-24/h12-20,23,26-28H,3-11H2,1-2H3,(H,29,31) |
| InChIKey | UBMYCMZWVKGDKB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.12 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|