C9H15N — CID 176835299
(8S)-3,3-dideuterio-8-methyl-6-methylidene-1,2,5,7-tetrahydropyrrolizine (PubChem CID 176835299) has the molecular formula C9H15N and a molecular weight of 139.24 g/mol. Its IUPAC name is (8S)-3,3-dideuterio-8-methyl-6-methylidene-1,2,5,7-tetrahydropyrrolizine.
| Compound Name | (8S)-3,3-dideuterio-8-methyl-6-methylidene-1,2,5,7-tetrahydropyrrolizine |
|---|---|
| PubChem CID | 176835299 |
| Molecular Formula | C9H15N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.13 |
| IUPAC Name | (8S)-3,3-dideuterio-8-methyl-6-methylidene-1,2,5,7-tetrahydropyrrolizine |
| SMILES | [2H]C1([2H])CC[C@@]2(C)CC(=C)CN12 |
| InChI | InChI=1S/C9H15N/c1-8-6-9(2)4-3-5-10(9)7-8/h1,3-7H2,2H3/t9-/m0/s1/i5D2 |
| InChIKey | OMKOUFAVIAUGMM-XBOVVARDSA-N |
| XLogP | 1.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|