C21H38N4OS — CID 176835796
2-(9-aminononylamino)-N-(4,5-dimethyl-1,3-thiazol-2-yl)cyclohexane-1-carboxamide (PubChem CID 176835796) has the molecular formula C21H38N4OS and a molecular weight of 394.63 g/mol. Its IUPAC name is 2-(9-aminononylamino)-N-(4,5-dimethyl-1,3-thiazol-2-yl)cyclohexane-1-carboxamide.
| Compound Name | 2-(9-aminononylamino)-N-(4,5-dimethyl-1,3-thiazol-2-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 176835796 |
| Molecular Formula | C21H38N4OS |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.28 |
| IUPAC Name | 2-(9-aminononylamino)-N-(4,5-dimethyl-1,3-thiazol-2-yl)cyclohexane-1-carboxamide |
| SMILES | Cc1nc(NC(=O)C2CCCCC2NCCCCCCCCCN)sc1C |
| InChI | InChI=1S/C21H38N4OS/c1-16-17(2)27-21(24-16)25-20(26)18-12-8-9-13-19(18)23-15-11-7-5-3-4-6-10-14-22/h18-19,23H,3-15,22H2,1-2H3,(H,24,25,26) |
| InChIKey | NXKBCEFHUIBBCG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|