C25H32O — CID 176836101
(2E,4E)-1-(4-tert-butylphenyl)-2-ethyl-1-phenylhepta-2,4-dien-1-ol (PubChem CID 176836101) has the molecular formula C25H32O and a molecular weight of 348.53 g/mol. Its IUPAC name is (2E,4E)-1-(4-tert-butylphenyl)-2-ethyl-1-phenylhepta-2,4-dien-1-ol.
| Compound Name | (2E,4E)-1-(4-tert-butylphenyl)-2-ethyl-1-phenylhepta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 176836101 |
| Molecular Formula | C25H32O |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (2E,4E)-1-(4-tert-butylphenyl)-2-ethyl-1-phenylhepta-2,4-dien-1-ol |
| SMILES | CC/C=C/C=C(\CC)C(O)(c1ccccc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H32O/c1-6-8-10-13-20(7-2)25(26,22-14-11-9-12-15-22)23-18-16-21(17-19-23)24(3,4)5/h8-19,26H,6-7H2,1-5H3/b10-8+,20-13+ |
| InChIKey | TVZXHGJWXDEODN-VMHIOKEMSA-N |
| XLogP | 6.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|