C13H18Br2N2O — CID 176836272
4-[[(2-amino-3,5-dibromo-4,6-dideuteriophenyl)-dideuteriomethyl]amino]cyclohexan-1-ol (PubChem CID 176836272) has the molecular formula C13H18Br2N2O and a molecular weight of 382.13 g/mol. Its IUPAC name is 4-[[(2-amino-3,5-dibromo-4,6-dideuteriophenyl)-dideuteriomethyl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[(2-amino-3,5-dibromo-4,6-dideuteriophenyl)-dideuteriomethyl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 176836272 |
| Molecular Formula | C13H18Br2N2O |
| Molecular Weight | 382.13 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | 4-[[(2-amino-3,5-dibromo-4,6-dideuteriophenyl)-dideuteriomethyl]amino]cyclohexan-1-ol |
| SMILES | [2H]c1c(Br)c([2H])c(C([2H])([2H])NC2CCC(O)CC2)c(N)c1Br |
| InChI | InChI=1S/C13H18Br2N2O/c14-9-5-8(13(16)12(15)6-9)7-17-10-1-3-11(18)4-2-10/h5-6,10-11,17-18H,1-4,7,16H2/i5D,6D,7D2 |
| InChIKey | JBDGDEWWOUBZPM-PYIBGHHLSA-N |
| XLogP | 3.19 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.13 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|