About 2-fluoro-N'-(5-methylhexyl)propane-1,3-diamine
2-fluoro-N'-(5-methylhexyl)propane-1,3-diamine (PubChem CID 176836483) has the molecular formula C10H23FN2
and a molecular weight of 190.31 g/mol. Its IUPAC name is 2-fluoro-N'-(5-methylhexyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | 2-fluoro-N'-(5-methylhexyl)propane-1,3-diamine |
| PubChem CID | 176836483 |
| Molecular Formula | C10H23FN2 |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.18 |
| IUPAC Name | 2-fluoro-N'-(5-methylhexyl)propane-1,3-diamine |
| SMILES | CC(C)CCCCNCC(F)CN |
| InChI | InChI=1S/C10H23FN2/c1-9(2)5-3-4-6-13-8-10(11)7-12/h9-10,13H,3-8,12H2,1-2H3 |
| InChIKey | WNOKKZNRMFBRGM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N'-(5-methylhexyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N'-(5-methylhexyl)propane-1,3-diamine?
The IUPAC name of 2-fluoro-N'-(5-methylhexyl)propane-1,3-diamine (CID 176836483) is 2-fluoro-N'-(5-methylhexyl)propane-1,3-diamine.
What is the SMILES notation for 2-fluoro-N'-(5-methylhexyl)propane-1,3-diamine?
The canonical SMILES for 2-fluoro-N'-(5-methylhexyl)propane-1,3-diamine is CC(C)CCCCNCC(F)CN.
What is the InChIKey of 2-fluoro-N'-(5-methylhexyl)propane-1,3-diamine?
The InChIKey is WNOKKZNRMFBRGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23FN2/c1-9(2)5-3-4-6-13-8-10(11)7-12/h9-10,13H,3-8,12H2,1-2H3.
What are the key properties of 2-fluoro-N'-(5-methylhexyl)propane-1,3-diamine?
2-fluoro-N'-(5-methylhexyl)propane-1,3-diamine has a molecular weight of 190.31 g/mol, XLogP of 1.70, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N'-(5-methylhexyl)propane-1,3-diamine is sourced from PubChem (CID 176836483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).