C26H29N7O2 — CID 176836734
7-[[6-[(dimethylamino)methyl]-5-(oxolan-3-yl)-2-pyridinyl]amino]-4-(1,7,8-triazatricyclo[4.3.0.02,4]nona-6,8-dien-9-yl)-2,3-dihydroisoindol-1-one (PubChem CID 176836734) has the molecular formula C26H29N7O2 and a molecular weight of 471.57 g/mol. Its IUPAC name is 7-[[6-[(dimethylamino)methyl]-5-(oxolan-3-yl)-2-pyridinyl]amino]-4-(1,7,8-triazatricyclo[4.3.0.02,4]nona-6,8-dien-9-yl)-2,3-dihydroisoindol-1-one.
| Compound Name | 7-[[6-[(dimethylamino)methyl]-5-(oxolan-3-yl)-2-pyridinyl]amino]-4-(1,7,8-triazatricyclo[4.3.0.02,4]nona-6,8-dien-9-yl)-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 176836734 |
| Molecular Formula | C26H29N7O2 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 7-[[6-[(dimethylamino)methyl]-5-(oxolan-3-yl)-2-pyridinyl]amino]-4-(1,7,8-triazatricyclo[4.3.0.02,4]nona-6,8-dien-9-yl)-2,3-dihydroisoindol-1-one |
| SMILES | CN(C)Cc1nc(Nc2ccc(-c3nnc4n3C3CC3C4)c3c2C(=O)NC3)ccc1C1CCOC1 |
| InChI | InChI=1S/C26H29N7O2/c1-32(2)12-20-16(14-7-8-35-13-14)4-6-22(29-20)28-19-5-3-17(18-11-27-26(34)24(18)19)25-31-30-23-10-15-9-21(15)33(23)25/h3-6,14-15,21H,7-13H2,1-2H3,(H,27,34)(H,28,29) |
| InChIKey | OCEHSHHCHAVTMS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |