C29H27FN6O3 — CID 176836738
(3R)-7-[[6-[(dimethylamino)methyl]-5-[(3S)-oxolan-3-yl]-2-pyridinyl]amino]-3-fluoro-4-(5-oxa-1,10-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)-2,3-dihydroisoindol-1-one (PubChem CID 176836738) has the molecular formula C29H27FN6O3 and a molecular weight of 526.57 g/mol. Its IUPAC name is (3R)-7-[[6-[(dimethylamino)methyl]-5-[(3S)-oxolan-3-yl]-2-pyridinyl]amino]-3-fluoro-4-(5-oxa-1,10-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)-2,3-dihydroisoindol-1-one.
| Compound Name | (3R)-7-[[6-[(dimethylamino)methyl]-5-[(3S)-oxolan-3-yl]-2-pyridinyl]amino]-3-fluoro-4-(5-oxa-1,10-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 176836738 |
| Molecular Formula | C29H27FN6O3 |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | (3R)-7-[[6-[(dimethylamino)methyl]-5-[(3S)-oxolan-3-yl]-2-pyridinyl]amino]-3-fluoro-4-(5-oxa-1,10-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)-2,3-dihydroisoindol-1-one |
| SMILES | CN(C)Cc1nc(Nc2ccc(-c3cnc4ccc5occc5n34)c3c2C(=O)N[C@@H]3F)ccc1[C@@H]1CCOC1 |
| InChI | InChI=1S/C29H27FN6O3/c1-35(2)14-20-17(16-9-11-38-15-16)4-7-24(33-20)32-19-5-3-18(26-27(19)29(37)34-28(26)30)22-13-31-25-8-6-23-21(36(22)25)10-12-39-23/h3-8,10,12-13,16,28H,9,11,14-15H2,1-2H3,(H,32,33)(H,34,37)/t16-,28+/m1/s1 |
| InChIKey | QXYIBQBPMSNMQP-HJWYETAXSA-N |
| XLogP | 5.16 |
| TPSA | 96.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|