C21H37O10P — CID 176838001
3-methylbut-3-enyl (2R,3S,4R,5R)-6-[bis(3-methylbut-3-enoxy)phosphoryloxy]-2,3,4,5-tetrahydroxyhexanoate (PubChem CID 176838001) has the molecular formula C21H37O10P and a molecular weight of 480.49 g/mol. Its IUPAC name is 3-methylbut-3-enyl (2R,3S,4R,5R)-6-[bis(3-methylbut-3-enoxy)phosphoryloxy]-2,3,4,5-tetrahydroxyhexanoate.
| Compound Name | 3-methylbut-3-enyl (2R,3S,4R,5R)-6-[bis(3-methylbut-3-enoxy)phosphoryloxy]-2,3,4,5-tetrahydroxyhexanoate |
|---|---|
| PubChem CID | 176838001 |
| Molecular Formula | C21H37O10P |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 3-methylbut-3-enyl (2R,3S,4R,5R)-6-[bis(3-methylbut-3-enoxy)phosphoryloxy]-2,3,4,5-tetrahydroxyhexanoate |
| SMILES | C=C(C)CCOC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(OCCC(=C)C)OCCC(=C)C |
| InChI | InChI=1S/C21H37O10P/c1-14(2)7-10-28-21(26)20(25)19(24)18(23)17(22)13-31-32(27,29-11-8-15(3)4)30-12-9-16(5)6/h17-20,22-25H,1,3,5,7-13H2,2,4,6H3/t17-,18-,19+,20-/m1/s1 |
| InChIKey | DVMNEYGGCBDHNJ-YSTOQKLRSA-N |
| XLogP | 2.03 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|