C12H10F2I2O7S — CID 176838586
2-[2-(4-ethenyl-2-hydroxy-3,6-diiodophenoxy)acetyl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 176838586) has the molecular formula C12H10F2I2O7S and a molecular weight of 590.08 g/mol. Its IUPAC name is 2-[2-(4-ethenyl-2-hydroxy-3,6-diiodophenoxy)acetyl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[2-(4-ethenyl-2-hydroxy-3,6-diiodophenoxy)acetyl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 176838586 |
| Molecular Formula | C12H10F2I2O7S |
| Molecular Weight | 590.08 g/mol |
| Exact Mass | 589.82 |
| IUPAC Name | 2-[2-(4-ethenyl-2-hydroxy-3,6-diiodophenoxy)acetyl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | C=Cc1cc(I)c(OCC(=O)OCC(F)(F)S(=O)(=O)O)c(O)c1I |
| InChI | InChI=1S/C12H10F2I2O7S/c1-2-6-3-7(15)11(10(18)9(6)16)22-4-8(17)23-5-12(13,14)24(19,20)21/h2-3,18H,1,4-5H2,(H,19,20,21) |
| InChIKey | XMFISOJQDPLIBM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.08 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|