C36H22O — CID 176840786
7,8,9,10-tetradeuterio-5-(10-phenylanthracen-9-yl)naphtho[1,2-b][1]benzofuran (PubChem CID 176840786) has the molecular formula C36H22O and a molecular weight of 474.60 g/mol. Its IUPAC name is 7,8,9,10-tetradeuterio-5-(10-phenylanthracen-9-yl)naphtho[1,2-b][1]benzofuran.
| Compound Name | 7,8,9,10-tetradeuterio-5-(10-phenylanthracen-9-yl)naphtho[1,2-b][1]benzofuran |
|---|---|
| PubChem CID | 176840786 |
| Molecular Formula | C36H22O |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 7,8,9,10-tetradeuterio-5-(10-phenylanthracen-9-yl)naphtho[1,2-b][1]benzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c4ccccc4c(-c4c5ccccc5c(-c5ccccc5)c5ccccc45)cc32)c1[2H] |
| InChI | InChI=1S/C36H22O/c1-2-12-23(13-3-1)34-26-16-5-7-18-28(26)35(29-19-8-6-17-27(29)34)31-22-32-25-15-10-11-21-33(25)37-36(32)30-20-9-4-14-24(30)31/h1-22H/i10D,11D,15D,21D |
| InChIKey | MCGFUNLFCDBDCP-SLNWCEDUSA-N |
| XLogP | 10.38 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|